* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 3-(2,4-DIFLUOROPHENYL)PYRIDINE |
| CAS: | 914349-57-8 |
| English Synonyms: | 3-(2,4-DIFLUOROPHENYL)PYRIDINE |
| MDL Number.: | MFCD05864843 |
| H bond acceptor: | 1 |
| H bond donor: | 0 |
| Smile: | c1cc(cnc1)c2ccc(cc2F)F |
| InChi: | InChI=1S/C11H7F2N/c12-9-3-4-10(11(13)6-9)8-2-1-5-14-7-8/h1-7H |
| InChiKey: | InChIKey=ZMQXDYBWFBWZES-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.