* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 2,2'-(1,3-Phenylenebis(oxy))diethanamine |
CAS: | 91484-92-3 |
English Synonyms: | 2,2'-(1,3-PHENYLENEBIS(OXY))DIETHANAMINE |
H bond acceptor: | 0 |
H bond donor: | 0 |
Smile: | C1(=CC(=CC=C1)OCCN)OCCN |
InChi: | InChI=1S/C10H16N2O2/c11-4-6-13-9-2-1-3-10(8-9)14-7-5-12/h1-3,8H,4-7,11-12H2 |
InChiKey: | InChIKey=VNAXBHXTHPELJH-UHFFFAOYSA-N |
Property |
|
Safety information |
* If the product has intellectual property rights, a license granted is must or contact us.