* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 2-(BENZOFURAN-4-YL)-4,4,5,5-TETRAMETHYL-1,3,2-DIOXABOROLANE |
| CAS: | 915412-92-9 |
| English Synonyms: | 2-(BENZOFURAN-4-YL)-4,4,5,5-TETRAMETHYL-1,3,2-DIOXABOROLANE |
| MDL Number.: | MFCD16995816 |
| H bond acceptor: | 3 |
| H bond donor: | 0 |
| Smile: | B1(OC(C(O1)(C)C)(C)C)c2cccc3c2cco3 |
| InChi: | InChI=1S/C14H17BO3/c1-13(2)14(3,4)18-15(17-13)11-6-5-7-12-10(11)8-9-16-12/h5-9H,1-4H3 |
| InChiKey: | InChIKey=QHBWRIRRPKKWSW-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.