Molecular Structure:
CAS No.:
916203-52-6
Product Name.:
CCD No.:CCD00619776
Formula:C5 H2 Br Cl I N
MolWeight:318.335
* If the product has intellectual property rights, a license granted is must or contact us.
- Detailed
- Suppliers(26)
- Buyers(0)
- Spectrum(0)
- MSDS(2)
- Price(10)
|
|
| Product Name： | 4-BROMO-2-CHLORO-3-IODOPYRIDINE |
| CAS： | 916203-52-6 |
| English Synonyms： | ABBYPHARMA AP-31-5900 ; 4-BROMO-2-CHLORO-3-IODOPYRIDINE |
| MDL Number.： | MFCD08060939 |
| H bond acceptor： | 1 |
| H bond donor： | 0 |
| Smile： | c1cnc(c(c1Br)I)Cl |
| InChi： | InChI=1S/C5H2BrClIN/c6-3-1-2-9-5(7)4(3)8/h1-2H |
| InChiKey： | InChIKey=ALKCOVKKTNNOGX-UHFFFAOYSA-N |
|
|
| Melting Point： | 94-97 DEG C |
| Comments： | RIDADR: UN 2811 6.1/PG 3 WGK: 3 |
|
|
| Symbol： |
GHS06
|
| Signal word： | Danger |
| Hazard statements： | H301-H315-H319-H335 |
| Precautionary statements： | P261-P301 + P310-P305 + P351 + P338 |
| hazard symbol： | Xn |
| Risk Code： | R:22-36/37/38 |
| Safe Code： | S:26 |
| WGK Germany： | 3 |
Basic Information
* If the product has intellectual property rights, a license granted is must or contact us.
