* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 8-BROMO-5-FLUOROQUINOLINE |
| CAS: | 917251-99-1 |
| English Synonyms: | 8-BROMO-5-FLUOROQUINOLINE |
| MDL Number.: | MFCD09907839 |
| H bond acceptor: | 1 |
| H bond donor: | 0 |
| Smile: | c1cc2c(ccc(c2nc1)Br)F |
| InChi: | InChI=1S/C9H5BrFN/c10-7-3-4-8(11)6-2-1-5-12-9(6)7/h1-5H |
| InChiKey: | InChIKey=OUZLPGJFGCOKJJ-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.