* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | (2S)-2,3-DIHYDRO-2-PHENYL-1H-INDOLE |
CAS: | 917377-78-7 |
English Synonyms: | (2S)-2,3-DIHYDRO-2-PHENYL-1H-INDOLE |
MDL Number.: | MFCD10698822 |
H bond acceptor: | 1 |
H bond donor: | 1 |
Smile: | c1ccc(cc1)[C@@H]2Cc3ccccc3N2 |
InChi: | InChI=1S/C14H13N/c1-2-6-11(7-3-1)14-10-12-8-4-5-9-13(12)15-14/h1-9,14-15H,10H2/t14-/m0/s1 |
InChiKey: | InChIKey=XZPFOJPRFUSEIH-AWEZNQCLSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.