* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | (R)-1-(PYRROLIDIN-3-YL)-1H-PYRAZOLE |
CAS: | 917560-79-3 |
English Synonyms: | (R)-1-(PYRROLIDIN-3-YL)-1H-PYRAZOLE |
MDL Number.: | MFCD13189971 |
H bond acceptor: | 3 |
H bond donor: | 1 |
Smile: | c1cnn(c1)[C@@H]2CCNC2 |
InChi: | InChI=1S/C7H11N3/c1-3-9-10(5-1)7-2-4-8-6-7/h1,3,5,7-8H,2,4,6H2/t7-/m1/s1 |
InChiKey: | InChIKey=ZUZKWDPTWJFIPQ-SSDOTTSWSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.