* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | GPI 688 |
| CAS: | 918902-32-6 |
| English Synonyms: | GPI 688 |
| MDL Number.: | MFCD12756390 |
| H bond acceptor: | 7 |
| H bond donor: | 4 |
| Smile: | c1ccc2c(c1)CC(C(=O)N2C[C@H](CO)O)NC(=O)c3cc4cc(sc4[nH]3)Cl |
| InChi: | InChI=1S/C19H18ClN3O4S/c20-16-7-11-6-13(22-18(11)28-16)17(26)21-14-5-10-3-1-2-4-15(10)23(19(14)27)8-12(25)9-24/h1-4,6-7,12,14,22,24-25H,5,8-9H2,(H,21,26)/t12-,14?/m1/s1 |
| InChiKey: | InChIKey=UICNBXVDHCBKCE-PUODRLBUSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.