* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | CP-66713 |
| CAS: | 91896-57-0 |
| English Synonyms: | 8-CHLORO-1-PHENYL-[1,2,4]TRIAZOLO[4,3-A]QUINOXALIN-4-AMINE ; CP-66713 |
| MDL Number.: | MFCD17215961 |
| H bond acceptor: | 5 |
| H bond donor: | 1 |
| Smile: | c1ccc(cc1)c2nnc3n2c4cc(ccc4nc3N)Cl |
| InChi: | InChI=1S/C15H10ClN5/c16-10-6-7-11-12(8-10)21-14(9-4-2-1-3-5-9)19-20-15(21)13(17)18-11/h1-8H,(H2,17,18) |
| InChiKey: | InChIKey=PBENJWAFQLORQL-UHFFFAOYSA-N |
|
|
|
|
| Symbol: |
GHS07
|
| Signal word: | Warning |
| Hazard statements: | H302-H315-H319-H335 |
| Precautionary statements: | P261-P305 + P351 + P338 |
| hazard symbol: | Xn |
| Risk Code: | R:22-36/37/38 |
| Safe Code: | S:26 |
| WGK Germany: | 3 |
* If the product has intellectual property rights, a license granted is must or contact us.