* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 1-(PYRIDIN-3-YL)-3-AZABICYCLO[3.1.0]HEXANE |
| CAS: | 919106-12-0 |
| English Synonyms: | 1-(PYRIDIN-3-YL)-3-AZABICYCLO[3.1.0]HEXANE |
| MDL Number.: | MFCD17010000 |
| H bond acceptor: | 2 |
| H bond donor: | 1 |
| Smile: | c1cc(cnc1)C23CC2CNC3 |
| InChi: | InChI=1S/C10H12N2/c1-2-8(5-11-3-1)10-4-9(10)6-12-7-10/h1-3,5,9,12H,4,6-7H2 |
| InChiKey: | InChIKey=GZQJGESMXWQLHS-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.