Molecular Structure:
CAS No.:
92175-75-2
Product Name.:
CCD No.:CCD00098682
Formula:C17 H21 N3 O5 S
MolWeight:379.435
* If the product has intellectual property rights, a license granted is must or contact us.
- Detailed
- Suppliers(4)
- Buyers(0)
- Spectrum(0)
- MSDS(0)
- Price(2)
|
|
| Product Name： | DANSYL-D-ALA-GLY |
| CAS： | 92175-75-2 |
| English Synonyms： | DANSYL-D-ALA-GLY |
| MDL Number.： | MFCD00214269 |
| H bond acceptor： | 8 |
| H bond donor： | 3 |
| Smile： | C[C@H](C(=O)NCC(=O)O)NS(=O)(=O)c1cccc2c1cccc2N(C)C |
| InChi： | InChI=1S/C17H21N3O5S/c1-11(17(23)18-10-16(21)22)19-26(24,25)15-9-5-6-12-13(15)7-4-8-14(12)20(2)3/h4-9,11,19H,10H2,1-3H3,(H,18,23)(H,21,22)/t11-/m1/s1 |
| InChiKey： | InChIKey=IKCPKYTWSUFCRD-LLVKDONJSA-N |
|
|
|
|
| WGK Germany： | 3 |
Basic Information
* If the product has intellectual property rights, a license granted is must or contact us.
