* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 2H-BENZOPYRAN,6-METHOXY-3-NITRO- |
| CAS: | 92210-61-2 |
| English Synonyms: | 2H-BENZOPYRAN,6-METHOXY-3-NITRO- |
| MDL Number.: | MFCD00063396 |
| H bond acceptor: | 5 |
| H bond donor: | 0 |
| Smile: | COc1ccc2c(c1)C=C(CO2)[N+](=O)[O-] |
| InChi: | InChI=1S/C10H9NO4/c1-14-9-2-3-10-7(5-9)4-8(6-15-10)11(12)13/h2-5H,6H2,1H3 |
| InChiKey: | InChIKey=JSEAVEVSSXGINF-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.