* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 7,9-DIMETHYL-1H,2H,3H,4H,5H-PYRIDO[4,3-B]INDOLE |
CAS: | 922511-57-7 |
English Synonyms: | 7,9-DIMETHYL-1H,2H,3H,4H,5H-PYRIDO[4,3-B]INDOLE ; 7,9-DIMETHYL-2,3,4,5-TETRAHYDRO-1H-PYRIDO[4,3-B]INDOLE |
MDL Number.: | MFCD12134472 |
H bond acceptor: | 2 |
H bond donor: | 2 |
Smile: | Cc1cc(c2c(c1)[nH]c3c2CNCC3)C |
InChi: | InChI=1S/C13H16N2/c1-8-5-9(2)13-10-7-14-4-3-11(10)15-12(13)6-8/h5-6,14-15H,3-4,7H2,1-2H3 |
InChiKey: | InChIKey=YLYAEPNZCVSVSB-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.