* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | ACETOPHENONE[RING-14C(U)] |
| CAS: | 92283-15-3 |
| English Synonyms: | ACETOPHENONE[RING-14C(U)] |
| MDL Number.: | MFCD00069965 |
| H bond acceptor: | 1 |
| H bond donor: | 0 |
| Smile: | CC(=O)[14c]1[14cH][14cH][14cH][14cH][14cH]1 |
| InChi: | InChI=1S/C8H8O/c1-7(9)8-5-3-2-4-6-8/h2-6H,1H3/i2+2,3+2,4+2,5+2,6+2,8+2 |
| InChiKey: | InChIKey=KWOLFJPFCHCOCG-MJXSPRQSSA-N |
|
|
|
|
* If the product has intellectual property rights, a license granted is must or contact us.