Molecular Structure:
CAS No.:
923561-79-9
Product Name.:
CCD No.:CCD00552025
Formula:C10 H10 D4
MolWeight:138.245
* If the product has intellectual property rights, a license granted is must or contact us.
- Detailed
- Suppliers(0)
- Buyers(0)
- Spectrum(0)
- MSDS(0)
- Price(0)
|
|
| Product Name： | 1,4-DIETHYLBENZENE-2,3,5,6-D4 |
| CAS： | 923561-79-9 |
| English Synonyms： | 1,4-DIETHYLBENZENE-2,3,5,6-D4 |
| MDL Number.： | MFCD06658881 |
| H bond acceptor： | 0 |
| H bond donor： | 0 |
| Smile： | [2H]c1c(c(c(c(c1CC)[2H])[2H])CC)[2H] |
| InChiKey： | InChIKey=null |
Basic Information
* If the product has intellectual property rights, a license granted is must or contact us.
