Molecular Structure:
CAS No.:
92565-91-8
;7371-42-8
Product Name.:
CCD No.:CCD00052885
Formula:C3 H D7
MolWeight:51.1389
* If the product has intellectual property rights, a license granted is must or contact us.
- Detailed
- Suppliers(3)
- Buyers(0)
- Spectrum(0)
- MSDS(0)
- Price(1)
|
|
| Product Name： | PROPANE-1,1,1,2,3,3,3-D7 |
| CAS： | 92565-91-8 ;7371-42-8 |
| English Synonyms： | PROPANE-1,1,1,2,3,3,3-D7 |
| MDL Number.： | MFCD00084173 |
| H bond acceptor： | 0 |
| H bond donor： | 0 |
| Smile： | [2H]C(C([2H])([2H])[2H])C([2H])([2H])[2H] |
| InChiKey： | InChIKey=null |
|
|
| Boiling Point： | -42.1 DEG C(LIT) |
| Physical Property： | FLASHPOINT: -104 DEG C FLASHPOINT: -155.2 DEG F |
| Comments： | MASS SHIFT: M+7 RIDADR: UN 1978 2.1 WGK: 1 |
| Information： | ISOTOPIC PURITY: 98 ATOM % D |
|
|
Basic Information
* If the product has intellectual property rights, a license granted is must or contact us.
