* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | H-D-ALA-D-ALA-D-ALA-D-ALA-OH |
| CAS: | 926-78-3 |
| English Synonyms: | H-D-ALA-D-ALA-D-ALA-D-ALA-OH |
| MDL Number.: | MFCD00003569 |
| H bond acceptor: | 9 |
| H bond donor: | 5 |
| Smile: | C[C@H](C(=O)N[C@H](C)C(=O)N[C@H](C)C(=O)N[C@H](C)C(=O)O)N |
| InChi: | InChI=1S/C12H22N4O5/c1-5(13)9(17)14-6(2)10(18)15-7(3)11(19)16-8(4)12(20)21/h5-8H,13H2,1-4H3,(H,14,17)(H,15,18)(H,16,19)(H,20,21)/t5-,6-,7-,8-/m1/s1 |
| InChiKey: | InChIKey=ZHRZLXZJVUFLNY-WCTZXXKLSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.