* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | TRANS-2-METHYL-1,5-HEPTADIEN-4-OL |
| CAS: | 926-98-7 |
| English Synonyms: | TRANS-2-METHYL-1,5-HEPTADIEN-4-OL ; (5E)-2-METHYLHEPTA-1,5-DIEN-4-OL ; 2-METHYL-1,5-HEPTADIEN-4-OL |
| MDL Number.: | MFCD00026993 |
| H bond acceptor: | 1 |
| H bond donor: | 1 |
| Smile: | C/C=C/C(CC(=C)C)O |
| InChi: | InChI=1S/C8H14O/c1-4-5-8(9)6-7(2)3/h4-5,8-9H,2,6H2,1,3H3/b5-4+ |
| InChiKey: | InChIKey=MDTLRZIDFDKYHS-SNAWJCMRSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.