* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | (R)-1-BENZYL-3-BUTYLPIPERAZINE |
CAS: | 928025-42-7 |
English Synonyms: | (R)-1-BENZYL-3-BUTYLPIPERAZINE |
MDL Number.: | MFCD13248826 |
H bond acceptor: | 2 |
H bond donor: | 1 |
Smile: | CCCC[C@@H]1CN(CCN1)Cc2ccccc2 |
InChi: | InChI=1S/C15H24N2/c1-2-3-9-15-13-17(11-10-16-15)12-14-7-5-4-6-8-14/h4-8,15-16H,2-3,9-13H2,1H3/t15-/m1/s1 |
InChiKey: | InChIKey=XESDITBVSGTNKQ-OAHLLOKOSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.