* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 10-BROMO-6,11-DIHYDRO-5H-BENZO[A]CARBAZOLE |
CAS: | 929534-79-2 |
English Synonyms: | 10-BROMO-6,11-DIHYDRO-5H-BENZO[A]CARBAZOLE |
MDL Number.: | MFCD17213616 |
H bond acceptor: | 1 |
H bond donor: | 1 |
Smile: | c1ccc-2c(c1)CCc3c2[nH]c4c3cccc4Br |
InChi: | InChI=1S/C16H12BrN/c17-14-7-3-6-12-13-9-8-10-4-1-2-5-11(10)15(13)18-16(12)14/h1-7,18H,8-9H2 |
InChiKey: | InChIKey=ZKFLPRUDERMTNJ-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.