* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 3-FLUORO-1,4'-BIPIPERIDINE |
CAS: | 929632-64-4 |
English Synonyms: | 3-FLUORO-1,4'-BIPIPERIDINE |
MDL Number.: | MFCD12546279 |
H bond acceptor: | 2 |
H bond donor: | 1 |
Smile: | C1CC(CN(C1)C2CCNCC2)F |
InChi: | InChI=1S/C10H19FN2/c11-9-2-1-7-13(8-9)10-3-5-12-6-4-10/h9-10,12H,1-8H2 |
InChiKey: | InChIKey=XKWSIRXMKQCDAI-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.