Molecular Structure:
CAS No.:
929972-54-3
Product Name.:
CCD No.:CCD00712004
Formula:C8 H6 Cl N3 O2
MolWeight:211.607
![2-(2-CHLOROACETYL)-2H,3H-[1,2,4]TRIAZOLO[4,3-A]PYRIDIN-3-ONE Detailed](../images/deli.png)
* If the product has intellectual property rights, a license granted is must or contact us.
- Detailed
- Suppliers(1)
- Buyers(0)
- Spectrum(0)
- MSDS(0)
- Price(1)
|
|
| Product Name： | 2-(2-CHLOROACETYL)-2H,3H-[1,2,4]TRIAZOLO[4,3-A]PYRIDIN-3-ONE |
| CAS： | 929972-54-3 |
| English Synonyms： | 2-(CHLOROACETYL)[1,2,4]TRIAZOLO[4,3-A]PYRIDIN-3(2H)-ONE ; 2-(2-CHLOROACETYL)-2H,3H-[1,2,4]TRIAZOLO[4,3-A]PYRIDIN-3-ONE ; 2-(2-CHLOROACETYL)-[1,2,4]TRIAZOLO[4,3-A]PYRIDIN-3-ONE |
| MDL Number.： | MFCD09040517 |
| H bond acceptor： | 5 |
| H bond donor： | 0 |
| Smile： | c1ccn2c(c1)nn(c2=O)C(=O)CCl |
| InChi： | InChI=1S/C8H6ClN3O2/c9-5-7(13)12-8(14)11-4-2-1-3-6(11)10-12/h1-4H,5H2 |
| InChiKey： | InChIKey=RDZVGUBFKRSRDL-UHFFFAOYSA-N |
Basic Information
* If the product has intellectual property rights, a license granted is must or contact us.
