* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 1'-METHYL-1H,1'H-[4,4'-BIPYRAZOL]-5-AMINE |
CAS: | 930300-12-2 |
English Synonyms: | 1'-METHYL-1H,1'H-[4,4'-BIPYRAZOL]-5-AMINE ; 1'-METHYL-[4,4'-BI-1H-PYRAZOL]-5-AMINE ; [4,4'-BI-1H-PYRAZOL]-5-AMINE, 1'-METHYL- |
MDL Number.: | MFCD13192347 |
H bond acceptor: | 5 |
H bond donor: | 2 |
Smile: | Cn1cc(cn1)c2cn[nH]c2N |
InChi: | InChI=1S/C7H9N5/c1-12-4-5(2-10-12)6-3-9-11-7(6)8/h2-4H,1H3,(H3,8,9,11) |
InChiKey: | InChIKey=VPJIDHLGGJAEOZ-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.