Molecular Structure:
CAS No.:
93187-78-1
Product Name.:
CCD No.:CCD00044984
Formula:C13 H15 N O2 S
MolWeight:249.333
![ETHYL 2-[(2-METHYL-1H-INDOL-3-YL)THIO]ACETATE Detailed](../images/deli.png)
* If the product has intellectual property rights, a license granted is must or contact us.
- Detailed
- Suppliers(9)
- Buyers(0)
- Spectrum(0)
- MSDS(0)
- Price(2)
|
|
| Product Name： | ETHYL 2-[(2-METHYL-1H-INDOL-3-YL)THIO]ACETATE |
| CAS： | 93187-78-1 |
| English Synonyms： | ETHYL 2-[(2-METHYL-1H-INDOL-3-YL)THIO]ACETATE |
| MDL Number.： | MFCD00068036 |
| H bond acceptor： | 3 |
| H bond donor： | 1 |
| Smile： | CCOC(=O)CSc1c([nH]c2c1cccc2)C |
| InChi： | InChI=1S/C13H15NO2S/c1-3-16-12(15)8-17-13-9(2)14-11-7-5-4-6-10(11)13/h4-7,14H,3,8H2,1-2H3 |
| InChiKey： | InChIKey=JGBGVTWDRSJBPN-UHFFFAOYSA-N |
Basic Information
* If the product has intellectual property rights, a license granted is must or contact us.
