* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | (6,7-DIHYDRO-4H-THIENO[3,2-C]PYRAN-2-YL)METHANAMINE |
| CAS: | 933696-81-2 |
| English Synonyms: | (6,7-DIHYDRO-4H-THIENO[3,2-C]PYRAN-2-YL)METHANAMINE |
| MDL Number.: | MFCD17169814 |
| H bond acceptor: | 2 |
| H bond donor: | 1 |
| Smile: | c1c2c(sc1CN)CCOC2 |
| InChi: | InChI=1S/C8H11NOS/c9-4-7-3-6-5-10-2-1-8(6)11-7/h3H,1-2,4-5,9H2 |
| InChiKey: | InChIKey=USOLXSACZBFWEK-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.