* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 1,3-Propanediamine, N1-(2-fluorophenyl)- |
CAS: | 933717-52-3 |
English Synonyms: | 1,3-PROPANEDIAMINE, N1-(2-FLUOROPHENYL)- |
H bond acceptor: | 0 |
H bond donor: | 0 |
Smile: | FC1=C(C=CC=C1)NCCCN |
InChi: | InChI=1S/C9H13FN2/c10-8-4-1-2-5-9(8)12-7-3-6-11/h1-2,4-5,12H,3,6-7,11H2 |
InChiKey: | InChIKey=ALNRNQZBLBBDPF-UHFFFAOYSA-N |
Property |
|
Safety information |
* If the product has intellectual property rights, a license granted is must or contact us.