* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 6,7,8,9-TETRAHYDRO-5H-[1,2,4]TRIAZOLO[4,3-A][1,4]DIAZEPINE |
CAS: | 933721-41-6 |
English Synonyms: | 5H-1,2,4-TRIAZOLO[4,3-A][1,4]DIAZEPINE, 6,7,8,9-TETRAHYDRO- ; 6,7,8,9-TETRAHYDRO-5H-[1,2,4]TRIAZOLO[4,3-A][1,4]DIAZEPINE |
MDL Number.: | MFCD17215709 |
H bond acceptor: | 4 |
H bond donor: | 1 |
Smile: | c1nnc2n1CCCNC2 |
InChi: | InChI=1S/C6H10N4/c1-2-7-4-6-9-8-5-10(6)3-1/h5,7H,1-4H2 |
InChiKey: | InChIKey=WSCUAIXTOAYBPS-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.