* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 5H-1,2,4-TRIAZOLO[4,3-D][1,4]DIAZEPINE, 6,7,8,9-TETRAHYDRO- |
| CAS: | 933725-97-4 |
| English Synonyms: | 5H-1,2,4-TRIAZOLO[4,3-D][1,4]DIAZEPINE, 6,7,8,9-TETRAHYDRO- ; 6,7,8,9-TETRAHYDRO-5H-[1,2,4]TRIAZOLO[4,3-D][1,4]DIAZEPINE |
| MDL Number.: | MFCD17215711 |
| H bond acceptor: | 4 |
| H bond donor: | 1 |
| Smile: | c1nnc2n1CCNCC2 |
| InChi: | InChI=1S/C6H10N4/c1-2-7-3-4-10-5-8-9-6(1)10/h5,7H,1-4H2 |
| InChiKey: | InChIKey=YSZKHHSJJRXSNW-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.