Molecular Structure:
CAS No.:
933725-97-4
Product Name.:
CCD No.:CCD03478226
Formula:C6 H10 N4
MolWeight:138.173
![5H-1,2,4-TRIAZOLO[4,3-D][1,4]DIAZEPINE, 6,7,8,9-TETRAHYDRO- Detailed](../images/deli.png)
* If the product has intellectual property rights, a license granted is must or contact us.
- Detailed
- Suppliers(4)
- Buyers(0)
- Spectrum(0)
- MSDS(0)
- Price(2)
|
|
| Product Name： | 5H-1,2,4-TRIAZOLO[4,3-D][1,4]DIAZEPINE, 6,7,8,9-TETRAHYDRO- |
| CAS： | 933725-97-4 |
| English Synonyms： | 6,7,8,9-TETRAHYDRO-5H-[1,2,4]TRIAZOLO[4,3-D][1,4]DIAZEPINE ; 5H-1,2,4-TRIAZOLO[4,3-D][1,4]DIAZEPINE, 6,7,8,9-TETRAHYDRO- |
| MDL Number.： | MFCD17215711 |
| H bond acceptor： | 4 |
| H bond donor： | 1 |
| Smile： | c1nnc2n1CCNCC2 |
| InChi： | InChI=1S/C6H10N4/c1-2-7-3-4-10-5-8-9-6(1)10/h5,7H,1-4H2 |
| InChiKey： | InChIKey=YSZKHHSJJRXSNW-UHFFFAOYSA-N |
Basic Information
* If the product has intellectual property rights, a license granted is must or contact us.
