* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 1-(3-PYRROLIDINYL)-1H-PYRROLE |
CAS: | 933727-76-5 |
English Synonyms: | 1-(3-PYRROLIDINYL)-1H-PYRROLE ; 1-(PYRROLIDIN-3-YL)-1H-PYRROLE |
MDL Number.: | MFCD12406999 |
H bond acceptor: | 2 |
H bond donor: | 1 |
Smile: | c1ccn(c1)C2CCNC2 |
InChi: | InChI=1S/C8H12N2/c1-2-6-10(5-1)8-3-4-9-7-8/h1-2,5-6,8-9H,3-4,7H2 |
InChiKey: | InChIKey=PXKNZBSAJCNQBN-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.