* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 4-METHYL-1,4-OXAZEPAN-6-AMINE |
CAS: | 933743-23-8 |
English Synonyms: | 4-METHYL-1,4-OXAZEPAN-6-AMINE |
MDL Number.: | MFCD12031260 |
H bond acceptor: | 3 |
H bond donor: | 1 |
Smile: | CN1CCOCC(C1)N |
InChi: | InChI=1S/C6H14N2O/c1-8-2-3-9-5-6(7)4-8/h6H,2-5,7H2,1H3 |
InChiKey: | InChIKey=LHDGPYWEWPDORQ-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.