* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 2-(4,5-DIMETHYL-1H-IMIDAZOL-2-YL)-PIPERIDINE |
CAS: | 933750-40-4 |
English Synonyms: | 2-(4,5-DIMETHYL-1H-IMIDAZOL-2-YL)-PIPERIDINE |
MDL Number.: | MFCD12105883 |
H bond acceptor: | 3 |
H bond donor: | 2 |
Smile: | Cc1c(nc([nH]1)C2CCCCN2)C |
InChi: | InChI=1S/C10H17N3/c1-7-8(2)13-10(12-7)9-5-3-4-6-11-9/h9,11H,3-6H2,1-2H3,(H,12,13) |
InChiKey: | InChIKey=KASZGCZZGGXXJZ-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.