Molecular Structure:
CAS No.:
934172-55-1
Product Name.:
CCD No.:CCD00875148
Formula:C5 H6 N2 O2
MolWeight:126.114
* If the product has intellectual property rights, a license granted is must or contact us.
- Detailed
- Suppliers(2)
- Buyers(0)
- Spectrum(0)
- MSDS(0)
- Price(2)
|
|
| Product Name： | 2-(1H-PYRAZOL-4-YL)ACETIC ACID |
| CAS： | 934172-55-1 |
| English Synonyms： | 2-(1H-PYRAZOL-4-YL)ACETIC ACID ; (1H-PYRAZOL-4-YL)-ACETIC ACID |
| MDL Number.： | MFCD09924911 |
| H bond acceptor： | 4 |
| H bond donor： | 2 |
| Smile： | c1c(cn[nH]1)CC(=O)O |
| InChi： | InChI=1S/C5H6N2O2/c8-5(9)1-4-2-6-7-3-4/h2-3H,1H2,(H,6,7)(H,8,9) |
| InChiKey： | InChIKey=PXWJTOHJADWQQO-UHFFFAOYSA-N |
Basic Information
* If the product has intellectual property rights, a license granted is must or contact us.
