* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 1-((5-AMINO-1,3,4-THIADIAZOL-2-YL)THIO)PROPAN-2-OL |
CAS: | 935289-76-2 |
English Synonyms: | 1-[(5-AMINO-1,3,4-THIADIAZOL-2-YL)SULFANYL]PROPAN-2-OL ; 1-((5-AMINO-1,3,4-THIADIAZOL-2-YL)THIO)PROPAN-2-OL |
MDL Number.: | MFCD12801484 |
H bond acceptor: | 4 |
H bond donor: | 2 |
Smile: | CC(CSc1nnc(s1)N)O |
InChi: | InChI=1S/C5H9N3OS2/c1-3(9)2-10-5-8-7-4(6)11-5/h3,9H,2H2,1H3,(H2,6,7) |
InChiKey: | InChIKey=FZRHXDSGFGGCMK-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.