* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 5-(4-IODO-PHENYL)-1H-IMIDAZOLE |
CAS: | 936842-72-7 |
English Synonyms: | 5-(4-IODO-PHENYL)-1H-IMIDAZOLE |
MDL Number.: | MFCD12024920 |
H bond acceptor: | 2 |
H bond donor: | 1 |
Smile: | c1cc(ccc1c2cnc[nH]2)I |
InChi: | InChI=1S/C9H7IN2/c10-8-3-1-7(2-4-8)9-5-11-6-12-9/h1-6H,(H,11,12) |
InChiKey: | InChIKey=ABUTYHQPVLBUFM-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.