* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 4-CHLORO-2-PROPYL-PYRIDINE |
| CAS: | 93856-98-5 |
| English Synonyms: | ABLOCK AB-12-3329 ; 4-CHLORO-2-PROPYL-PYRIDINE |
| MDL Number.: | MFCD09031441 |
| H bond acceptor: | 1 |
| H bond donor: | 0 |
| Smile: | CCCc1cc(ccn1)Cl |
| InChi: | InChI=1S/C8H10ClN/c1-2-3-8-6-7(9)4-5-10-8/h4-6H,2-3H2,1H3 |
| InChiKey: | InChIKey=XACBIHLRDPQCGQ-UHFFFAOYSA-N |
|
|
|
|
* If the product has intellectual property rights, a license granted is must or contact us.