* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 8-PHENYL-1,4-DIOXASPIRO[4,5]DECAN-8-OL |
| CAS: | 94112-58-0 |
| English Synonyms: | 8-PHENYL-1,4-DIOXASPIRO[4,5]DECAN-8-OL |
| MDL Number.: | MFCD06410870 |
| H bond acceptor: | 3 |
| H bond donor: | 1 |
| Smile: | c1ccc(cc1)C2(CCC3(CC2)OCCO3)O |
| InChi: | InChI=1S/C14H18O3/c15-13(12-4-2-1-3-5-12)6-8-14(9-7-13)16-10-11-17-14/h1-5,15H,6-11H2 |
| InChiKey: | InChIKey=JUTTXLGMDSGZCE-UHFFFAOYSA-N |
|
|
|
|
* If the product has intellectual property rights, a license granted is must or contact us.