* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 8-METHYL-1-OXASPIRO[4.5]DECAN-2-ONE |
| CAS: | 94201-19-1 |
| English Synonyms: | 8-METHYL-1-OXASPIRO[4.5]DECAN-2-ONE |
| MDL Number.: | MFCD09908254 |
| H bond acceptor: | 2 |
| H bond donor: | 0 |
| Smile: | CC1CCC2(CC1)CCC(=O)O2 |
| InChi: | InChI=1S/C10H16O2/c1-8-2-5-10(6-3-8)7-4-9(11)12-10/h8H,2-7H2,1H3 |
| InChiKey: | InChIKey=COWIMPXRUUJKQF-UHFFFAOYSA-N |
|
|
|
|
* If the product has intellectual property rights, a license granted is must or contact us.