* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 2,2'-(5-METHYLTHIOPHENE-2,4-DIYL)BIS(4,4,5,5-TETRAMETHYL-1,3,2-DIOXABOROLANE) |
| CAS: | 942070-30-6 |
| English Synonyms: | 2,2'-(5-METHYLTHIOPHENE-2,4-DIYL)BIS(4,4,5,5-TETRAMETHYL-1,3,2-DIOXABOROLANE) |
| MDL Number.: | MFCD12407257 |
| H bond acceptor: | 4 |
| H bond donor: | 0 |
| Smile: | B1(OC(C(O1)(C)C)(C)C)c2cc(sc2C)B3OC(C(O3)(C)C)(C)C |
| InChi: | InChI=1S/C17H28B2O4S/c1-11-12(18-20-14(2,3)15(4,5)21-18)10-13(24-11)19-22-16(6,7)17(8,9)23-19/h10H,1-9H3 |
| InChiKey: | InChIKey=JGURGLQQJZHJNG-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.