* If the product has intellectual property rights, a license granted is must or contact us.
|
|
Product Name: | WALSURONOID B |
CAS: | 942582-15-2 |
English Synonyms: | WALSURONOID B |
MDL Number.: | MFCD20260662 |
H bond acceptor: | 6 |
H bond donor: | 3 |
Smile: | CC1(C(=O)C=C[C@]2(C1=C(C(=O)[C@@]3([C@@H]2[C@H](CC4=C(C[C@H]([C@]43C)O)c5ccoc5)O)C)O)C)C |
InChi: | InChI=1S/C26H30O6/c1-23(2)17(28)6-8-24(3)20-16(27)11-15-14(13-7-9-32-12-13)10-18(29)25(15,4)26(20,5)22(31)19(30)21(23)24/h6-9,12,16,18,20,27,29-30H,10-11H2,1-5H3/t16-,18+,20+,24+,25-,26-/m0/s1 |
InChiKey: | InChIKey=XXFWAJSCCSMNPP-FTGJQZKBSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.