Molecular Structure:
CAS No.:
94391-12-5
Product Name.:
CCD No.:CCD00050166
Formula:C21 H26 O2 T4
MolWeight:322.498
![(1,2,6,7-3H[N])-PROGESTERONE Detailed](../images/deli.png)
* If the product has intellectual property rights, a license granted is must or contact us.
- Detailed
- Suppliers(4)
- Buyers(0)
- Spectrum(0)
- MSDS(0)
- Price(0)
|
|
| Product Name： | (1,2,6,7-3H[N])-PROGESTERONE |
| CAS： | 94391-12-5 |
| English Synonyms： | (1,2,6,7-3H[N])-PROGESTERONE |
| MDL Number.： | MFCD00079244 |
| H bond acceptor： | 2 |
| H bond donor： | 0 |
| Smile： | [3H]C1C(C2=CC(=O)C(C([C@@]2([C@@H]3[C@@H]1[C@@H]4CC[C@@H]([C@]4(CC3)C)C(=O)C)C)[3H])[3H])[3H] |
| InChiKey： | InChIKey=null |
Basic Information
* If the product has intellectual property rights, a license granted is must or contact us.
