* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | PYRAZINO[1',2':1,6]PYRIDO[3,4-B]INDOLE-3-PROPANOIC ACID, 1,2,3,4,6,7,12,12A-OCTAHYDRO-1,4-DIOXO-, (3S,12AS)- |
CAS: | 944073-26-1 |
English Synonyms: | PYRAZINO[1',2':1,6]PYRIDO[3,4-B]INDOLE-3-PROPANOIC ACID, 1,2,3,4,6,7,12,12A-OCTAHYDRO-1,4-DIOXO-, (3S,12AS)- |
MDL Number.: | MFCD11977476 |
H bond acceptor: | 7 |
H bond donor: | 3 |
Smile: | c1ccc2c(c1)c3c([nH]2)CN4[C@@H](C3)C(=O)N[C@H](C4=O)CCC(=O)O |
InChi: | InChI=1S/C17H17N3O4/c21-15(22)6-5-12-17(24)20-8-13-10(7-14(20)16(23)19-12)9-3-1-2-4-11(9)18-13/h1-4,12,14,18H,5-8H2,(H,19,23)(H,21,22)/t12-,14-/m0/s1 |
InChiKey: | InChIKey=KZOKLBPMHYCEFM-JSGCOSHPSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.