* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 5-(5-BROMOPYRIDIN-2-YL)-1,3,4-OXADIAZOL-2-AMINE |
| CAS: | 944718-29-0 |
| English Synonyms: | 5-(5-BROMOPYRIDIN-2-YL)-1,3,4-OXADIAZOL-2-AMINE |
| MDL Number.: | MFCD17259186 |
| H bond acceptor: | 5 |
| H bond donor: | 1 |
| Smile: | c1cc(ncc1Br)c2nnc(o2)N |
| InChi: | InChI=1S/C7H5BrN4O/c8-4-1-2-5(10-3-4)6-11-12-7(9)13-6/h1-3H,(H2,9,12) |
| InChiKey: | InChIKey=LCURBDWCMSYHQB-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.