* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 5,6-DIFLUORO-1H-INDAZOLE |
| CAS: | 944898-96-8 |
| English Synonyms: | 5,6-DIFLUORO-1H-INDAZOLE ; 1H-INDAZOLE, 5,6-DIFLUORO- |
| MDL Number.: | MFCD09997804 |
| H bond acceptor: | 2 |
| H bond donor: | 1 |
| Smile: | c1c2cn[nH]c2cc(c1F)F |
| InChi: | InChI=1S/C7H4F2N2/c8-5-1-4-3-10-11-7(4)2-6(5)9/h1-3H,(H,10,11) |
| InChiKey: | InChIKey=JNGSIOXFVHBGMU-UHFFFAOYSA-N |
|
|
|
|
* If the product has intellectual property rights, a license granted is must or contact us.