* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | ABBYPHARMA AP-10-1474 |
CAS: | 944903-73-5 |
English Synonyms: | ABBYPHARMA AP-10-1474 |
MDL Number.: | MFCD16988082 |
H bond acceptor: | 6 |
H bond donor: | 2 |
Smile: | CCOC(=O)C1=CN=C(CN)NC1=O |
InChi: | InChI=1S/C8H11N3O3/c1-2-14-8(13)5-4-10-6(3-9)11-7(5)12/h4H,2-3,9H2,1H3,(H,10,11,12) |
InChiKey: | InChIKey=HSVAJVMDAONEAP-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.