* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 1,3,4-OXADIAZOLE-2-CARBOXYLIC ACID |
CAS: | 944907-12-4 |
English Synonyms: | 1,3,4-OXADIAZOLE-2-CARBOXYLIC ACID |
MDL Number.: | MFCD10696534 |
H bond acceptor: | 5 |
H bond donor: | 1 |
Smile: | c1nnc(o1)C(=O)O |
InChi: | InChI=1S/C3H2N2O3/c6-3(7)2-5-4-1-8-2/h1H,(H,6,7) |
InChiKey: | InChIKey=GYZPQJVSAQBAHP-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.