* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 4-(3-BROMOPYRAZOLO[1,5-A]PYRIMIDIN-6-YL)PHENOL |
| CAS: | 945376-95-4 |
| English Synonyms: | 4-(3-BROMOPYRAZOLO[1,5-A]PYRIMIDIN-6-YL)PHENOL |
| MDL Number.: | MFCD13193719 |
| H bond acceptor: | 4 |
| H bond donor: | 1 |
| Smile: | c1cc(ccc1c2cnc3c(cnn3c2)Br)O |
| InChi: | InChI=1S/C12H8BrN3O/c13-11-6-15-16-7-9(5-14-12(11)16)8-1-3-10(17)4-2-8/h1-7,17H |
| InChiKey: | InChIKey=XBHIAJWNXVJSAA-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.