Molecular Structure:
CAS No.:
945556-86-5
Product Name.:
CCD No.:CCD01805033
Formula:C9 H7 Br N2 O2
MolWeight:255.07
* If the product has intellectual property rights, a license granted is must or contact us.
- Detailed
- Suppliers(5)
- Buyers(0)
- Spectrum(0)
- MSDS(0)
- Price(0)
|
|
| Product Name： | 3-BROMO-1-METHYL-6-NITRO-1H-INDOLE |
| CAS： | 945556-86-5 |
| English Synonyms： | 1H-INDOLE, 3-BROMO-1-METHYL-6-NITRO- ; 3-BROMO-1-METHYL-6-NITRO-1H-INDOLE |
| MDL Number.： | MFCD12755849 |
| H bond acceptor： | 4 |
| H bond donor： | 0 |
| Smile： | Cn1cc(c2c1cc(cc2)[N+](=O)[O-])Br |
| InChi： | InChI=1S/C9H7BrN2O2/c1-11-5-8(10)7-3-2-6(12(13)14)4-9(7)11/h2-5H,1H3 |
| InChiKey： | InChIKey=QFBXCHNFAVYUJX-UHFFFAOYSA-N |
Basic Information
* If the product has intellectual property rights, a license granted is must or contact us.
