* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | PYRROLO[2,1,5-DE]QUINOLIZIN-3-ONE |
| CAS: | 94562-77-3 |
| English Synonyms: | PYRROLO[2,1,5-DE]QUINOLIZIN-3-ONE |
| MDL Number.: | MFCD13178365 |
| H bond acceptor: | 2 |
| H bond donor: | 0 |
| Smile: | c1cc2ccc3n2c(c1)ccc3=O |
| InChi: | InChI=1S/C11H7NO/c13-11-7-5-9-3-1-2-8-4-6-10(11)12(8)9/h1-7H |
| InChiKey: | InChIKey=KTKKOTQSPZNWRF-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.