* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | PYRROLO[2,1,5-DE]QUINOLIZIN-5-ONE |
CAS: | 94562-88-6 |
English Synonyms: | PYRROLO[2,1,5-DE]QUINOLIZIN-5-ONE |
MDL Number.: | MFCD13178369 |
H bond acceptor: | 2 |
H bond donor: | 0 |
Smile: | c1cc2ccc3n2c(c1)c(=O)cc3 |
InChi: | InChI=1S/C11H7NO/c13-11-7-6-9-5-4-8-2-1-3-10(11)12(8)9/h1-7H |
InChiKey: | InChIKey=PJWQDBHFXZUJAS-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.