* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | N-PROPENOYL CAMPHOR-10,2-SULTAM |
| CAS: | 94594-91-9 |
| English Synonyms: | N-PROPENOYL CAMPHOR-10,2-SULTAM |
| MDL Number.: | MFCD16876465 |
| H bond acceptor: | 4 |
| H bond donor: | 0 |
| Smile: | CC1([C@@H]2CC[C@]13CS(=O)(=O)N(C3C2)C(=O)C=C)C |
| InChi: | InChI=1S/C13H19NO3S/c1-4-11(15)14-10-7-9-5-6-13(10,12(9,2)3)8-18(14,16)17/h4,9-10H,1,5-8H2,2-3H3/t9-,10?,13-/m1/s1 |
| InChiKey: | InChIKey=QYWKUFBZHFLMBU-NDAPUWOLSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.